nuranati1506 nuranati1506

18-03-2024
Chemistry

contestada

Is CH3CH2CH(CH3CH2)CH(CH3)CH2(CH3) 3-ethyl-4,5-dimethylpentane ?

Respuesta :

bb2533745 bb2533745

18-03-2024

Answer:

yed it's true

Explanation:

or else 1,2-dimethyl-3-ethylpentane

Answer Link

Otras preguntas

We like hot weather we always goes to the beach to swim what the correct answer

how did Eisenhower plan to prevent communist revolution in other contries?

which measurement tool is the best choice for measuring the area of a small picture frame?

In order to attend to the communication you must ________________________. a. avoid distractions b. turn off competing messages c. make an effort d. all of the

What would happen if you removed the cuticle from a plant's leaves? A) the leaves would absorb more water and grow better B) the leaves would be unable to exch

identify the type of chemical bond in a molecule reactant O2(g) + energy ---> O(g) + O(g)

Mark each statement if it describes a key characteristic of Athenian democracy. A. All free males over 18 born to Athenian parents were citizens. B. All citize

From what perspective is a memoir usually told?

Ten boys share 7 cereal bars equally.What fraction of a cereal bar does each boy get?

how are predator/ prey and parasite/host relationships similar