Andy100100 Andy100100

19-12-2020
Biology

contestada

Does anyone knows the skeletal structure for this one?

Does anyone knows the skeletal structure for this one class=

Respuesta :

raduoprea160 raduoprea160

19-12-2020

CH3-CH(CH3)-CH2-CH2-CH2-C(CH3)2-CH(CH3)-CH3

it's named

2,3,3,7-tertamethyloctane

Ver imagen raduoprea160

Answer Link

Otras preguntas

if you triple one eighth of my number you get 9

What advantages did the Spanish have over native Americans?

Imagine that you are a scientist studying DNA. You measure the number of cytosines and thymines in a small strand of DNA. There are 45 cytosines and 55 thymines

What is 473 rounded to the nearest hundred?

What is seperation of powers

What is the slope-intercept form of the function that contains the points (3, 1) and (2, 9)?

is freight have long a sound

18% of 81 is what number?

karl needs to build a stage that has an area of 72 square feet. the length of the stage should be longer than the width. what are the possible whole number meas

in 25 years, how much movement will result from a fault that slowly slips 1.5 centimeters per year?