Ju1i017
Ju1i017
16-12-2022
Computers and Technology
contestada
What is an Array known as in Python?
Respuesta :
VER TODAS LAS RESPUESTAS ( 84+ )
Otras preguntas
What is the difference between a hard drive and a tape drive? Hard drives use magnetic heads and are fast to write data; tape drives write to disks and are fast
what can be the basis for the division of a country in Federal structure give the introduction to each of them ?
For the polynomial 6xy2-5x?y?+9x? to be a trinomial with a degree of 3 after it has been fully simplified, what is the missing exponent of the y in the second t
HELPPPPPPPPPPPPPPPPP PLZ
A rectangle is twice as long as it is wide. Its width is 51⁄2 cm. Find the area of the rectangle.
Which function is shown in the graph? A. y = (2 + x)/(1 - x) B. y = 5/(3 - x) c . y = (5x)/(1 + x) d. y = (5 + 3x)/(1 + x)
A rectangle has a length of 27 inches less than 4 times it’s width. If the area of the rectangle is 2790 square inches, find the length of the rectangle
6. 792 = * A. (7 x 10) + (3 x 4) + (2 x 1) B. (7 x 11) + (3 x 3) + (2 x 1) C. (7 x 11) + (3 x 4) + (2 x 1) D. (7 x 10) + (3 x 3) + (2 x 1)
If a cylindrical vessel is 12 cm long and its surface area is 540 cm2, set up an equation to find its radius.
Draw the following structures and name them : I. CH3CH2(OH) II.CH3CH2CH(CH3)C(Cl)2C(l)2CH(F)OH III.CH3CH(CH3)CHO IV.CH2=CH(OH) V.CH3OCH2CH3